About ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide
ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide (PubChem CID 145197968) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide |
| PubChem CID | 145197968 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide |
| SMILES | CC.NC(=O)CCNc1cccnc1.[H][H] |
| InChI | InChI=1S/C8H11N3O.C2H6.H2/c9-8(12)3-5-11-7-2-1-4-10-6-7;1-2;/h1-2,4,6,11H,3,5H2,(H2,9,12);1-2H3;1H |
| InChIKey | VTDKSVWDKFTWCQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide?
The IUPAC name of ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide (CID 145197968) is ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide.
What is the SMILES notation for ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide?
The canonical SMILES for ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide is CC.NC(=O)CCNc1cccnc1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide?
The InChIKey is VTDKSVWDKFTWCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O.C2H6.H2/c9-8(12)3-5-11-7-2-1-4-10-6-7;1-2;/h1-2,4,6,11H,3,5H2,(H2,9,12);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide?
ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide has a molecular weight of 197.28 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;3-(pyridin-3-ylamino)propanamide is sourced from PubChem (CID 145197968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).