About propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one
propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one (PubChem CID 145198136) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one |
| PubChem CID | 145198136 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one |
| SMILES | C=C(C)/N=C/C(=C)OCCCN1CCCC1=O.CCC |
| InChI | InChI=1S/C13H20N2O2.C3H8/c1-11(2)14-10-12(3)17-9-5-8-15-7-4-6-13(15)16;1-3-2/h10H,1,3-9H2,2H3;3H2,1-2H3/b14-10+; |
| InChIKey | CWQHWDPCUAABPQ-KMZJGFRYSA-N |
| XLogP | 3.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one?
The IUPAC name of propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one (CID 145198136) is propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one.
What is the SMILES notation for propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one?
The canonical SMILES for propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one is C=C(C)/N=C/C(=C)OCCCN1CCCC1=O.CCC.
What is the InChIKey of propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one?
The InChIKey is CWQHWDPCUAABPQ-KMZJGFRYSA-N. The full InChI is InChI=1S/C13H20N2O2.C3H8/c1-11(2)14-10-12(3)17-9-5-8-15-7-4-6-13(15)16;1-3-2/h10H,1,3-9H2,2H3;3H2,1-2H3/b14-10+;.
What are the key properties of propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one?
propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one has a molecular weight of 280.41 g/mol, XLogP of 3.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;1-[3-(3-prop-1-en-2-yliminoprop-1-en-2-yloxy)propyl]pyrrolidin-2-one is sourced from PubChem (CID 145198136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).