C20H27N — CID 145198715
ethane;6-methyl-N-[(E)-2-methyl-1-phenylbut-1-enyl]cyclohexa-2,4-dien-1-imine (PubChem CID 145198715) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is ethane;6-methyl-N-[(E)-2-methyl-1-phenylbut-1-enyl]cyclohexa-2,4-dien-1-imine.
| Compound Name | ethane;6-methyl-N-[(E)-2-methyl-1-phenylbut-1-enyl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145198715 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | ethane;6-methyl-N-[(E)-2-methyl-1-phenylbut-1-enyl]cyclohexa-2,4-dien-1-imine |
| SMILES | CC.CC/C(C)=C(/N=C1\C=CC=CC1C)c1ccccc1 |
| InChI | InChI=1S/C18H21N.C2H6/c1-4-14(2)18(16-11-6-5-7-12-16)19-17-13-9-8-10-15(17)3;1-2/h5-13,15H,4H2,1-3H3;1-2H3/b18-14+,19-17+; |
| InChIKey | FDMYZDJJQLKJKN-JAGYBWIQSA-N |
| XLogP | 6.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|