C14H28N2O — CID 145199678
ethane;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine;methanimine (PubChem CID 145199678) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine;methanimine.
| Compound Name | ethane;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine;methanimine |
|---|---|
| PubChem CID | 145199678 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | ethane;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine;methanimine |
| SMILES | C/C=C\C(=C\C)NC1CCCCO1.CC.[H]N=C |
| InChI | InChI=1S/C11H19NO.C2H6.CH3N/c1-3-7-10(4-2)12-11-8-5-6-9-13-11;2*1-2/h3-4,7,11-12H,5-6,8-9H2,1-2H3;1-2H3;2H,1H2/b7-3-,10-4-;; |
| InChIKey | QMWVHCKYZGOOAB-IEKDYYNOSA-N |
| XLogP | 3.87 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|