C11H19NO — CID 145199679
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine (PubChem CID 145199679) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine |
|---|---|
| PubChem CID | 145199679 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]oxan-2-amine |
| SMILES | C/C=C\C(=C\C)NC1CCCCO1 |
| InChI | InChI=1S/C11H19NO/c1-3-7-10(4-2)12-11-8-5-6-9-13-11/h3-4,7,11-12H,5-6,8-9H2,1-2H3/b7-3-,10-4- |
| InChIKey | ISKAAPZNFULUKU-BHMKDNBBSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|