C27H37BrN4O4S2 — CID 145202169
tert-butyl 3-(6-bromo-2,3-dihydro-1,3-benzothiazol-2-yl)-2-[3-(2-methoxyethylamino)propanoylamino]-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 145202169) has the molecular formula C27H37BrN4O4S2 and a molecular weight of 625.65 g/mol. Its IUPAC name is tert-butyl 3-(6-bromo-2,3-dihydro-1,3-benzothiazol-2-yl)-2-[3-(2-methoxyethylamino)propanoylamino]-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-(6-bromo-2,3-dihydro-1,3-benzothiazol-2-yl)-2-[3-(2-methoxyethylamino)propanoylamino]-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 145202169 |
| Molecular Formula | C27H37BrN4O4S2 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | tert-butyl 3-(6-bromo-2,3-dihydro-1,3-benzothiazol-2-yl)-2-[3-(2-methoxyethylamino)propanoylamino]-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1C1Nc3ccc(Br)cc3S1)CC(C)N(C(=O)OC(C)(C)C)C2C |
| InChI | InChI=1S/C27H37BrN4O4S2/c1-15-13-18-22(24-30-19-8-7-17(28)14-20(19)37-24)25(31-21(33)9-10-29-11-12-35-6)38-23(18)16(2)32(15)26(34)36-27(3,4)5/h7-8,14-16,24,29-30H,9-13H2,1-6H3,(H,31,33) |
| InChIKey | QONKKZCFXIJIMM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|