C10H16N4 — CID 145202700
N,6-dimethylimidazo[1,2-a]pyrazin-8-amine;ethane (PubChem CID 145202700) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N,6-dimethylimidazo[1,2-a]pyrazin-8-amine;ethane.
| Compound Name | N,6-dimethylimidazo[1,2-a]pyrazin-8-amine;ethane |
|---|---|
| PubChem CID | 145202700 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N,6-dimethylimidazo[1,2-a]pyrazin-8-amine;ethane |
| SMILES | CC.CNc1nc(C)cn2ccnc12 |
| InChI | InChI=1S/C8H10N4.C2H6/c1-6-5-12-4-3-10-8(12)7(9-2)11-6;1-2/h3-5H,1-2H3,(H,9,11);1-2H3 |
| InChIKey | RBNKNMLLGRPKEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |