C7H7IN4 — CID 146178980
6-iodo-N-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 146178980) has the molecular formula C7H7IN4 and a molecular weight of 274.07 g/mol. Its IUPAC name is 6-iodo-N-methylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-iodo-N-methylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 146178980 |
| Molecular Formula | C7H7IN4 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 6-iodo-N-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CNc1nc(I)cn2ccnc12 |
| InChI | InChI=1S/C7H7IN4/c1-9-6-7-10-2-3-12(7)4-5(8)11-6/h2-4H,1H3,(H,9,11) |
| InChIKey | NLPWCVQQKGAWEI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|