C27H30N6O3 — CID 145202708
methyl 7-[4-[[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]heptanoate (PubChem CID 145202708) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is methyl 7-[4-[[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 145202708 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | methyl 7-[4-[[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]heptanoate |
| SMILES | [H]/N=C/c1ccc(-c2cn3ccnc3c(Nc3ccc(OCCCCCCC(=O)OC)cc3)n2)cc1N |
| InChI | InChI=1S/C27H30N6O3/c1-35-25(34)6-4-2-3-5-15-36-22-11-9-21(10-12-22)31-26-27-30-13-14-33(27)18-24(32-26)19-7-8-20(17-28)23(29)16-19/h7-14,16-18,28H,2-6,15,29H2,1H3,(H,31,32)/b28-17+ |
| InChIKey | WXNXSKNDSJKEEN-OGLMXYFKSA-N |
| XLogP | 5.22 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|