C33H44N8O2 — CID 142373368
(4aR)-N-[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine;ethane (PubChem CID 142373368) has the molecular formula C33H44N8O2 and a molecular weight of 584.77 g/mol. Its IUPAC name is (4aR)-N-[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine;ethane.
| Compound Name | (4aR)-N-[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine;ethane |
|---|---|
| PubChem CID | 142373368 |
| Molecular Formula | C33H44N8O2 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | (4aR)-N-[6-(3-amino-4-methanimidoylphenyl)imidazo[1,2-a]pyrazin-8-yl]-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine;ethane |
| SMILES | CC.CC.[H]/N=C/c1ccc(-c2cn3ccnc3c(Nc3ccc4c(c3)OC[C@H]3CN(C5CCOCC5)CCN43)n2)cc1N |
| InChI | InChI=1S/C29H32N8O2.2C2H6/c30-15-20-2-1-19(13-24(20)31)25-17-36-8-7-32-29(36)28(34-25)33-21-3-4-26-27(14-21)39-18-23-16-35(9-10-37(23)26)22-5-11-38-12-6-22;2*1-2/h1-4,7-8,13-15,17,22-23,30H,5-6,9-12,16,18,31H2,(H,33,34);2*1-2H3/b30-15+;;/t23-;;/m1../s1 |
| InChIKey | FUVPGYIHQGHMEJ-ISURJVJKSA-N |
| XLogP | 5.83 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|