C17H20O2 — CID 145204630
(1Z,5Z)-3-methyl-6-prop-2-enyl-3,8,11,12-tetrahydro-4-benzoxecin-7-one (PubChem CID 145204630) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1Z,5Z)-3-methyl-6-prop-2-enyl-3,8,11,12-tetrahydro-4-benzoxecin-7-one.
| Compound Name | (1Z,5Z)-3-methyl-6-prop-2-enyl-3,8,11,12-tetrahydro-4-benzoxecin-7-one |
|---|---|
| PubChem CID | 145204630 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (1Z,5Z)-3-methyl-6-prop-2-enyl-3,8,11,12-tetrahydro-4-benzoxecin-7-one |
| SMILES | C=CC/C1=C/OC(C)/C=C\C2=C(C=CCC2)CC1=O |
| InChI | InChI=1S/C17H20O2/c1-3-6-16-12-19-13(2)9-10-14-7-4-5-8-15(14)11-17(16)18/h3,5,8-10,12-13H,1,4,6-7,11H2,2H3/b10-9-,16-12- |
| InChIKey | MEZCQVCELOXFCJ-ZQJDLNAESA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|