C14H20O2 — CID 177225653
(3-methyl-6-prop-2-enylcyclohexa-1,5-dien-1-yl) 2-methylpropanoate (PubChem CID 177225653) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (3-methyl-6-prop-2-enylcyclohexa-1,5-dien-1-yl) 2-methylpropanoate.
| Compound Name | (3-methyl-6-prop-2-enylcyclohexa-1,5-dien-1-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 177225653 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3-methyl-6-prop-2-enylcyclohexa-1,5-dien-1-yl) 2-methylpropanoate |
| SMILES | C=CCC1=CCC(C)C=C1OC(=O)C(C)C |
| InChI | InChI=1S/C14H20O2/c1-5-6-12-8-7-11(4)9-13(12)16-14(15)10(2)3/h5,8-11H,1,6-7H2,2-4H3 |
| InChIKey | JOAINVBYQWPWJM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|