C16H19FN2O — CID 123437979
1-(4-fluoro-6-prop-2-enylcyclohexa-1,5-dien-1-yl)-4-(1H-imidazol-5-yl)butan-1-one (PubChem CID 123437979) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(4-fluoro-6-prop-2-enylcyclohexa-1,5-dien-1-yl)-4-(1H-imidazol-5-yl)butan-1-one.
| Compound Name | 1-(4-fluoro-6-prop-2-enylcyclohexa-1,5-dien-1-yl)-4-(1H-imidazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 123437979 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(4-fluoro-6-prop-2-enylcyclohexa-1,5-dien-1-yl)-4-(1H-imidazol-5-yl)butan-1-one |
| SMILES | C=CCC1=CC(F)CC=C1C(=O)CCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H19FN2O/c1-2-4-12-9-13(17)7-8-15(12)16(20)6-3-5-14-10-18-11-19-14/h2,8-11,13H,1,3-7H2,(H,18,19) |
| InChIKey | HAWSWICJCVXNAH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|