C10H18N4 — CID 143882858
(Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine (PubChem CID 143882858) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 143882858 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine |
| SMILES | CCN/C=C(\N)CCCc1cnc[nH]1 |
| InChI | InChI=1S/C10H18N4/c1-2-12-6-9(11)4-3-5-10-7-13-8-14-10/h6-8,12H,2-5,11H2,1H3,(H,13,14)/b9-6- |
| InChIKey | PKZOTEHAYVHVCO-TWGQIWQCSA-N |
| XLogP | 1.14 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |