C20H31N5O — CID 143882857
(Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine;N-(3-phenylpropyl)formamide (PubChem CID 143882857) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine;N-(3-phenylpropyl)formamide.
| Compound Name | (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine;N-(3-phenylpropyl)formamide |
|---|---|
| PubChem CID | 143882857 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | (Z)-1-N-ethyl-5-(1H-imidazol-5-yl)pent-1-ene-1,2-diamine;N-(3-phenylpropyl)formamide |
| SMILES | CCN/C=C(\N)CCCc1cnc[nH]1.O=CNCCCc1ccccc1 |
| InChI | InChI=1S/C10H18N4.C10H13NO/c1-2-12-6-9(11)4-3-5-10-7-13-8-14-10;12-9-11-8-4-7-10-5-2-1-3-6-10/h6-8,12H,2-5,11H2,1H3,(H,13,14);1-3,5-6,9H,4,7-8H2,(H,11,12)/b9-6-; |
| InChIKey | IKCDQUWORYDNDE-BORNJIKYSA-N |
| XLogP | 2.51 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|