C17H24N4O — CID 24755417
N-benzyl-5-[2-(1H-imidazol-5-yl)ethylamino]pentanamide (PubChem CID 24755417) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-benzyl-5-[2-(1H-imidazol-5-yl)ethylamino]pentanamide.
| Compound Name | N-benzyl-5-[2-(1H-imidazol-5-yl)ethylamino]pentanamide |
|---|---|
| PubChem CID | 24755417 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-benzyl-5-[2-(1H-imidazol-5-yl)ethylamino]pentanamide |
| SMILES | O=C(CCCCNCCc1cnc[nH]1)NCc1ccccc1 |
| InChI | InChI=1S/C17H24N4O/c22-17(20-12-15-6-2-1-3-7-15)8-4-5-10-18-11-9-16-13-19-14-21-16/h1-3,6-7,13-14,18H,4-5,8-12H2,(H,19,21)(H,20,22) |
| InChIKey | FBZWVTXMODHJPK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|