C29H33BN4O4 — CID 145205494
3-[[[2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-4-yl]amino]methyl]phenol (PubChem CID 145205494) has the molecular formula C29H33BN4O4 and a molecular weight of 512.42 g/mol. Its IUPAC name is 3-[[[2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-4-yl]amino]methyl]phenol.
| Compound Name | 3-[[[2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-4-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 145205494 |
| Molecular Formula | C29H33BN4O4 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 3-[[[2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-4-yl]amino]methyl]phenol |
| SMILES | Cc1cc2c(B3OC(C)(C)C(C)(C)O3)cccc2n1-c1nc(NCc2cccc(O)c2)c2c(n1)OCCC2 |
| InChI | InChI=1S/C29H33BN4O4/c1-18-15-22-23(30-37-28(2,3)29(4,5)38-30)12-7-13-24(22)34(18)27-32-25(21-11-8-14-36-26(21)33-27)31-17-19-9-6-10-20(35)16-19/h6-7,9-10,12-13,15-16,35H,8,11,14,17H2,1-5H3,(H,31,32,33) |
| InChIKey | XCNHXJKPCFPZND-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|