C27H38O12 — CID 14521029
(2R,3R,4S,5R)-2-[(2S,3S)-4-hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]oxane-3,4,5-triol (PubChem CID 14521029) has the molecular formula C27H38O12 and a molecular weight of 554.59 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[(2S,3S)-4-hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[(2S,3S)-4-hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 14521029 |
| Molecular Formula | C27H38O12 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-[(2S,3S)-4-hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]oxane-3,4,5-triol |
| SMILES | COc1cc(C[C@H](CO)[C@@H](CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)Cc2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C27H38O12/c1-34-19-7-14(8-20(35-2)24(19)31)5-16(11-28)17(12-38-27-26(33)23(30)18(29)13-39-27)6-15-9-21(36-3)25(32)22(10-15)37-4/h7-10,16-18,23,26-33H,5-6,11-13H2,1-4H3/t16-,17-,18-,23+,26-,27-/m1/s1 |
| InChIKey | UTPBCUCEDIRSFI-KHLXKNNCSA-N |
| XLogP | 0.60 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |