C39H43NO12 — CID 145210466
2-(2,5-dioxocyclopent-3-en-1-yl)acetaldehyde;2-(2,5-dioxopyrrol-1-yl)acetaldehyde;7-(2-methylprop-2-enoyloxy)heptyl 2-methoxy-5-(4-methoxyphenyl)benzoate (PubChem CID 145210466) has the molecular formula C39H43NO12 and a molecular weight of 717.77 g/mol. Its IUPAC name is 2-(2,5-dioxocyclopent-3-en-1-yl)acetaldehyde;2-(2,5-dioxopyrrol-1-yl)acetaldehyde;7-(2-methylprop-2-enoyloxy)heptyl 2-methoxy-5-(4-methoxyphenyl)benzoate.
| Compound Name | 2-(2,5-dioxocyclopent-3-en-1-yl)acetaldehyde;2-(2,5-dioxopyrrol-1-yl)acetaldehyde;7-(2-methylprop-2-enoyloxy)heptyl 2-methoxy-5-(4-methoxyphenyl)benzoate |
|---|---|
| PubChem CID | 145210466 |
| Molecular Formula | C39H43NO12 |
| Molecular Weight | 717.77 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | 2-(2,5-dioxocyclopent-3-en-1-yl)acetaldehyde;2-(2,5-dioxopyrrol-1-yl)acetaldehyde;7-(2-methylprop-2-enoyloxy)heptyl 2-methoxy-5-(4-methoxyphenyl)benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCOC(=O)c1cc(-c2ccc(OC)cc2)ccc1OC.O=CCC1C(=O)C=CC1=O.O=CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H32O6.C7H6O3.C6H5NO3/c1-19(2)25(27)31-16-8-6-5-7-9-17-32-26(28)23-18-21(12-15-24(23)30-4)20-10-13-22(29-3)14-11-20;8-4-3-5-6(9)1-2-7(5)10;8-4-3-7-5(9)1-2-6(7)10/h10-15,18H,1,5-9,16-17H2,2-4H3;1-2,4-5H,3H2;1-2,4H,3H2 |
| InChIKey | YOVNVPBWRWGEQL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 176.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|