C23H18N2O — CID 145210922
(E)-3-phenyl-1-(4-quinoxalin-2-ylcyclohexa-1,3-dien-1-yl)prop-2-en-1-one (PubChem CID 145210922) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is (E)-3-phenyl-1-(4-quinoxalin-2-ylcyclohexa-1,3-dien-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-(4-quinoxalin-2-ylcyclohexa-1,3-dien-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 145210922 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (E)-3-phenyl-1-(4-quinoxalin-2-ylcyclohexa-1,3-dien-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=CC=C(c2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H18N2O/c26-23(15-10-17-6-2-1-3-7-17)19-13-11-18(12-14-19)22-16-24-20-8-4-5-9-21(20)25-22/h1-11,13,15-16H,12,14H2/b15-10+ |
| InChIKey | ICLLGHSLRMVDPQ-XNTDXEJSSA-N |
| XLogP | 5.02 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|