C16H15Br — CID 129162911
[(1Z)-3-(4-bromocyclohexa-1,3-dien-1-yl)buta-1,3-dienyl]benzene (PubChem CID 129162911) has the molecular formula C16H15Br and a molecular weight of 287.20 g/mol. Its IUPAC name is [(1Z)-3-(4-bromocyclohexa-1,3-dien-1-yl)buta-1,3-dienyl]benzene.
| Compound Name | [(1Z)-3-(4-bromocyclohexa-1,3-dien-1-yl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 129162911 |
| Molecular Formula | C16H15Br |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [(1Z)-3-(4-bromocyclohexa-1,3-dien-1-yl)buta-1,3-dienyl]benzene |
| SMILES | C=C(/C=C\c1ccccc1)C1=CC=C(Br)CC1 |
| InChI | InChI=1S/C16H15Br/c1-13(15-9-11-16(17)12-10-15)7-8-14-5-3-2-4-6-14/h2-9,11H,1,10,12H2/b8-7- |
| InChIKey | LDRDHLOOYRRYRG-FPLPWBNLSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|