C13H22N4O — CID 145217447
ethane-1,2-diimine;4-phenylmethoxybutane-1,2-diamine (PubChem CID 145217447) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is ethane-1,2-diimine;4-phenylmethoxybutane-1,2-diamine.
| Compound Name | ethane-1,2-diimine;4-phenylmethoxybutane-1,2-diamine |
|---|---|
| PubChem CID | 145217447 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | ethane-1,2-diimine;4-phenylmethoxybutane-1,2-diamine |
| SMILES | NCC(N)CCOCc1ccccc1.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C11H18N2O.C2H4N2/c12-8-11(13)6-7-14-9-10-4-2-1-3-5-10;3-1-2-4/h1-5,11H,6-9,12-13H2;1-4H/b;3-1+,4-2+ |
| InChIKey | RBJDTPOIJUVGKR-BZGZIVBQSA-N |
| XLogP | 1.16 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|