C25H31N3O4S — CID 145220187
N-cyclohexyl-4-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide;formic acid (PubChem CID 145220187) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide;formic acid.
| Compound Name | N-cyclohexyl-4-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide;formic acid |
|---|---|
| PubChem CID | 145220187 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-cyclohexyl-4-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide;formic acid |
| SMILES | CCN(C(=O)Cn1c(C(=O)NC2CCCCC2)cc2sccc21)c1cccc(C)c1.O=CO |
| InChI | InChI=1S/C24H29N3O2S.CH2O2/c1-3-26(19-11-7-8-17(2)14-19)23(28)16-27-20-12-13-30-22(20)15-21(27)24(29)25-18-9-5-4-6-10-18;2-1-3/h7-8,11-15,18H,3-6,9-10,16H2,1-2H3,(H,25,29);1H,(H,2,3) |
| InChIKey | IYVPXAGPZZFFKJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|