C27H32N2O2S — CID 149114226
2-[5-[2-(4-ethenylcyclohexyl)acetyl]thieno[3,2-b]pyrrol-4-yl]-N-ethyl-N-(3-methylphenyl)acetamide (PubChem CID 149114226) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is 2-[5-[2-(4-ethenylcyclohexyl)acetyl]thieno[3,2-b]pyrrol-4-yl]-N-ethyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[5-[2-(4-ethenylcyclohexyl)acetyl]thieno[3,2-b]pyrrol-4-yl]-N-ethyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 149114226 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[5-[2-(4-ethenylcyclohexyl)acetyl]thieno[3,2-b]pyrrol-4-yl]-N-ethyl-N-(3-methylphenyl)acetamide |
| SMILES | C=CC1CCC(CC(=O)c2cc3sccc3n2CC(=O)N(CC)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C27H32N2O2S/c1-4-20-9-11-21(12-10-20)16-25(30)24-17-26-23(13-14-32-26)29(24)18-27(31)28(5-2)22-8-6-7-19(3)15-22/h4,6-8,13-15,17,20-21H,1,5,9-12,16,18H2,2-3H3 |
| InChIKey | ABOPEWSMAIRHOM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|