C19H21N3O2S — CID 151158966
4-[2-(N,3-diethylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 151158966) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[2-(N,3-diethylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[2-(N,3-diethylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 151158966 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[2-(N,3-diethylanilino)-2-oxoethyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCc1cccc(N(CC)C(=O)Cn2c(C(N)=O)cc3sccc32)c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-3-13-6-5-7-14(10-13)21(4-2)18(23)12-22-15-8-9-25-17(15)11-16(22)19(20)24/h5-11H,3-4,12H2,1-2H3,(H2,20,24) |
| InChIKey | MZVXVEWJBMSOPF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |