C19H18N4OS2 — CID 22552236
N-ethyl-N-(3-methylphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide (PubChem CID 22552236) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-ethyl-N-(3-methylphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide.
| Compound Name | N-ethyl-N-(3-methylphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22552236 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-ethyl-N-(3-methylphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
| SMILES | CCN(C(=O)CSc1nncn2c1cc1sccc12)c1cccc(C)c1 |
| InChI | InChI=1S/C19H18N4OS2/c1-3-22(14-6-4-5-13(2)9-14)18(24)11-26-19-16-10-17-15(7-8-25-17)23(16)12-20-21-19/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | BSUBQMWNRFIKKF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |