C18H17N5O3S3 — CID 22552242
N-[2-(4-sulfamoylphenyl)ethyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide (PubChem CID 22552242) has the molecular formula C18H17N5O3S3 and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22552242 |
| Molecular Formula | C18H17N5O3S3 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CSc2nncn3c2cc2sccc23)cc1 |
| InChI | InChI=1S/C18H17N5O3S3/c19-29(25,26)13-3-1-12(2-4-13)5-7-20-17(24)10-28-18-15-9-16-14(6-8-27-16)23(15)11-21-22-18/h1-4,6,8-9,11H,5,7,10H2,(H,20,24)(H2,19,25,26) |
| InChIKey | FWQDFYGRFWEGMH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |