C18H16N4OS2 — CID 22552244
N-[(4-methylphenyl)methyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide (PubChem CID 22552244) has the molecular formula C18H16N4OS2 and a molecular weight of 368.49 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide.
| Compound Name | N-[(4-methylphenyl)methyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22552244 |
| Molecular Formula | C18H16N4OS2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2nncn3c2cc2sccc23)cc1 |
| InChI | InChI=1S/C18H16N4OS2/c1-12-2-4-13(5-3-12)9-19-17(23)10-25-18-15-8-16-14(6-7-24-16)22(15)11-20-21-18/h2-8,11H,9-10H2,1H3,(H,19,23) |
| InChIKey | HEDTWFJJJRJUIX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |