C34H42ClN7O3 — CID 145220614
N-[4-[3-chloro-4-[(3-methyl-1,2,3,4-tetrahydroquinoxalin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide (PubChem CID 145220614) has the molecular formula C34H42ClN7O3 and a molecular weight of 632.21 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-methyl-1,2,3,4-tetrahydroquinoxalin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide.
| Compound Name | N-[4-[3-chloro-4-[(3-methyl-1,2,3,4-tetrahydroquinoxalin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide |
|---|---|
| PubChem CID | 145220614 |
| Molecular Formula | C34H42ClN7O3 |
| Molecular Weight | 632.21 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-methyl-1,2,3,4-tetrahydroquinoxalin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide |
| SMILES | CCOc1cc2c(cc1NC(=O)CCCN(C)C)C(Nc1ccc(OCC3Nc4ccccc4NC3C)c(Cl)c1)C(C#N)CN2 |
| InChI | InChI=1S/C34H42ClN7O3/c1-5-44-32-17-28-24(16-29(32)41-33(43)11-8-14-42(3)4)34(22(18-36)19-37-28)39-23-12-13-31(25(35)15-23)45-20-30-21(2)38-26-9-6-7-10-27(26)40-30/h6-7,9-10,12-13,15-17,21-22,30,34,37-40H,5,8,11,14,19-20H2,1-4H3,(H,41,43) |
| InChIKey | LXTHAZNJVZXAQX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.21 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|