C30H40ClFN6O3 — CID 145220682
N-[4-[3-chloro-4-[(6-fluoropiperidin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide (PubChem CID 145220682) has the molecular formula C30H40ClFN6O3 and a molecular weight of 587.14 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(6-fluoropiperidin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide.
| Compound Name | N-[4-[3-chloro-4-[(6-fluoropiperidin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide |
|---|---|
| PubChem CID | 145220682 |
| Molecular Formula | C30H40ClFN6O3 |
| Molecular Weight | 587.14 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | N-[4-[3-chloro-4-[(6-fluoropiperidin-2-yl)methoxy]anilino]-3-cyano-7-ethoxy-1,2,3,4-tetrahydroquinolin-6-yl]-4-(dimethylamino)butanamide |
| SMILES | CCOc1cc2c(cc1NC(=O)CCCN(C)C)C(Nc1ccc(OCC3CCCC(F)N3)c(Cl)c1)C(C#N)CN2 |
| InChI | InChI=1S/C30H40ClFN6O3/c1-4-40-27-15-24-22(14-25(27)37-29(39)9-6-12-38(2)3)30(19(16-33)17-34-24)36-20-10-11-26(23(31)13-20)41-18-21-7-5-8-28(32)35-21/h10-11,13-15,19,21,28,30,34-36H,4-9,12,17-18H2,1-3H3,(H,37,39) |
| InChIKey | RISSINFJRMFKGB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.14 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|