C33H33ClN4O2 — CID 145220571
6-(benzylamino)-4-[3-chloro-4-(cyclohepta-1,2,3-trien-1-ylmethoxy)anilino]-7-ethoxy-1,2,3,4-tetrahydroquinoline-3-carbonitrile (PubChem CID 145220571) has the molecular formula C33H33ClN4O2 and a molecular weight of 553.11 g/mol. Its IUPAC name is 6-(benzylamino)-4-[3-chloro-4-(cyclohepta-1,2,3-trien-1-ylmethoxy)anilino]-7-ethoxy-1,2,3,4-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 6-(benzylamino)-4-[3-chloro-4-(cyclohepta-1,2,3-trien-1-ylmethoxy)anilino]-7-ethoxy-1,2,3,4-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 145220571 |
| Molecular Formula | C33H33ClN4O2 |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 6-(benzylamino)-4-[3-chloro-4-(cyclohepta-1,2,3-trien-1-ylmethoxy)anilino]-7-ethoxy-1,2,3,4-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCOc1cc2c(cc1NCc1ccccc1)C(Nc1ccc(OCC3=C=C=CCCC3)c(Cl)c1)C(C#N)CN2 |
| InChI | InChI=1S/C33H33ClN4O2/c1-2-39-32-18-29-27(17-30(32)36-20-23-10-8-5-9-11-23)33(25(19-35)21-37-29)38-26-14-15-31(28(34)16-26)40-22-24-12-6-3-4-7-13-24/h3,5,8-11,14-18,25,33,36-38H,2,4,7,13,20-22H2,1H3 |
| InChIKey | KVPGUDCXRLYWOG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|