C11H11FN4OS — CID 1452221
2-(1-ethyltetrazol-5-yl)sulfanyl-1-(2-fluorophenyl)ethanone (PubChem CID 1452221) has the molecular formula C11H11FN4OS and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 1452221 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(2-fluorophenyl)ethanone |
| SMILES | CCn1nnnc1SCC(=O)c1ccccc1F |
| InChI | InChI=1S/C11H11FN4OS/c1-2-16-11(13-14-15-16)18-7-10(17)8-5-3-4-6-9(8)12/h3-6H,2,7H2,1H3 |
| InChIKey | INFVZFADQWTDHP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |