C12H24O2 — CID 145222521
ethane;1,5,5,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-3-ol (PubChem CID 145222521) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;1,5,5,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-3-ol.
| Compound Name | ethane;1,5,5,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 145222521 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | ethane;1,5,5,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
| SMILES | CC.CC1(C)CC(O)CC2(C)OC12C |
| InChI | InChI=1S/C10H18O2.C2H6/c1-8(2)5-7(11)6-9(3)10(8,4)12-9;1-2/h7,11H,5-6H2,1-4H3;1-2H3 |
| InChIKey | LWCWBSKZUCJYTI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|