C43H54N2O10 — CID 145223091
ethane;2-(2-methylprop-2-enoyloxy)ethyl 16-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2,3,4-trimethyl-5,10-dioxo-6,9-dioxapentacyclo[10.6.1.114,17.01,11.013,18]icosane-15-carboxylate (PubChem CID 145223091) has the molecular formula C43H54N2O10 and a molecular weight of 758.91 g/mol. Its IUPAC name is ethane;2-(2-methylprop-2-enoyloxy)ethyl 16-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2,3,4-trimethyl-5,10-dioxo-6,9-dioxapentacyclo[10.6.1.114,17.01,11.013,18]icosane-15-carboxylate.
| Compound Name | ethane;2-(2-methylprop-2-enoyloxy)ethyl 16-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2,3,4-trimethyl-5,10-dioxo-6,9-dioxapentacyclo[10.6.1.114,17.01,11.013,18]icosane-15-carboxylate |
|---|---|
| PubChem CID | 145223091 |
| Molecular Formula | C43H54N2O10 |
| Molecular Weight | 758.91 g/mol |
| Exact Mass | 758.38 |
| IUPAC Name | ethane;2-(2-methylprop-2-enoyloxy)ethyl 16-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2,3,4-trimethyl-5,10-dioxo-6,9-dioxapentacyclo[10.6.1.114,17.01,11.013,18]icosane-15-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1C2CC(C1C(=O)Nc1ccc(Oc3ccc(N)cc3)cc1)C1C2C2CC13C(C)C(C)C(C)C(=O)OCCOC(=O)C23.CC |
| InChI | InChI=1S/C41H48N2O10.C2H6/c1-20(2)37(45)49-14-16-51-39(47)33-28-18-29(32(33)36(44)43-25-8-12-27(13-9-25)53-26-10-6-24(42)7-11-26)34-31(28)30-19-41(34)23(5)21(3)22(4)38(46)50-15-17-52-40(48)35(30)41;1-2/h6-13,21-23,28-35H,1,14-19,42H2,2-5H3,(H,43,44);1-2H3 |
| InChIKey | KOSKGTIPMQTDAF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.91 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|