C34H38N2O10 — CID 145223101
2-(2-methylprop-2-enoyloxy)ethyl (8Z)-12-[[4-(4-aminophenoxy)phenyl]carbamoyl]-8,9,10-trimethyl-2,7-dioxo-3,6-dioxabicyclo[9.2.0]tridec-8-ene-13-carboxylate (PubChem CID 145223101) has the molecular formula C34H38N2O10 and a molecular weight of 634.68 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (8Z)-12-[[4-(4-aminophenoxy)phenyl]carbamoyl]-8,9,10-trimethyl-2,7-dioxo-3,6-dioxabicyclo[9.2.0]tridec-8-ene-13-carboxylate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (8Z)-12-[[4-(4-aminophenoxy)phenyl]carbamoyl]-8,9,10-trimethyl-2,7-dioxo-3,6-dioxabicyclo[9.2.0]tridec-8-ene-13-carboxylate |
|---|---|
| PubChem CID | 145223101 |
| Molecular Formula | C34H38N2O10 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (8Z)-12-[[4-(4-aminophenoxy)phenyl]carbamoyl]-8,9,10-trimethyl-2,7-dioxo-3,6-dioxabicyclo[9.2.0]tridec-8-ene-13-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1C(C(=O)Nc2ccc(Oc3ccc(N)cc3)cc2)C2C(C)/C(C)=C(/C)C(=O)OCCOC(=O)C12 |
| InChI | InChI=1S/C34H38N2O10/c1-18(2)31(38)42-14-16-45-34(41)29-27(26-20(4)19(3)21(5)32(39)43-15-17-44-33(40)28(26)29)30(37)36-23-8-12-25(13-9-23)46-24-10-6-22(35)7-11-24/h6-13,20,26-29H,1,14-17,35H2,2-5H3,(H,36,37)/b21-19- |
| InChIKey | AFSXEFPWGJLIAH-VZCXRCSSSA-N |
| XLogP | 4.21 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|