C10H19NO — CID 145224593
(E)-2,3,3,4-tetramethylhex-4-enamide (PubChem CID 145224593) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-2,3,3,4-tetramethylhex-4-enamide.
| Compound Name | (E)-2,3,3,4-tetramethylhex-4-enamide |
|---|---|
| PubChem CID | 145224593 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E)-2,3,3,4-tetramethylhex-4-enamide |
| SMILES | C/C=C(\C)C(C)(C)C(C)C(N)=O |
| InChI | InChI=1S/C10H19NO/c1-6-7(2)10(4,5)8(3)9(11)12/h6,8H,1-5H3,(H2,11,12)/b7-6+ |
| InChIKey | LQGOVPYUNYEWBT-VOTSOKGWSA-N |
| XLogP | 2.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|