C23H32FN5O2 — CID 145224672
ethane;5-[[5-fluoro-2-[2-(methylamino)hexoxy]phenyl]methylamino]pyrazolo[1,5-a]pyrimidine-3-carbaldehyde (PubChem CID 145224672) has the molecular formula C23H32FN5O2 and a molecular weight of 429.54 g/mol. Its IUPAC name is ethane;5-[[5-fluoro-2-[2-(methylamino)hexoxy]phenyl]methylamino]pyrazolo[1,5-a]pyrimidine-3-carbaldehyde.
| Compound Name | ethane;5-[[5-fluoro-2-[2-(methylamino)hexoxy]phenyl]methylamino]pyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 145224672 |
| Molecular Formula | C23H32FN5O2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | ethane;5-[[5-fluoro-2-[2-(methylamino)hexoxy]phenyl]methylamino]pyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
| SMILES | CC.CCCCC(COc1ccc(F)cc1CNc1ccn2ncc(C=O)c2n1)NC |
| InChI | InChI=1S/C21H26FN5O2.C2H6/c1-3-4-5-18(23-2)14-29-19-7-6-17(22)10-15(19)11-24-20-8-9-27-21(26-20)16(13-28)12-25-27;1-2/h6-10,12-13,18,23H,3-5,11,14H2,1-2H3,(H,24,26);1-2H3 |
| InChIKey | HHGQFZZFWWSBDY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|