C16H14F3IN4O — CID 155135728
N-[1-[2-(2,2-difluoroethoxy)-5-fluorophenyl]ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 155135728) has the molecular formula C16H14F3IN4O and a molecular weight of 462.21 g/mol. Its IUPAC name is N-[1-[2-(2,2-difluoroethoxy)-5-fluorophenyl]ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[1-[2-(2,2-difluoroethoxy)-5-fluorophenyl]ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 155135728 |
| Molecular Formula | C16H14F3IN4O |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | N-[1-[2-(2,2-difluoroethoxy)-5-fluorophenyl]ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CC(Nc1ccn2ncc(I)c2n1)c1cc(F)ccc1OCC(F)F |
| InChI | InChI=1S/C16H14F3IN4O/c1-9(11-6-10(17)2-3-13(11)25-8-14(18)19)22-15-4-5-24-16(23-15)12(20)7-21-24/h2-7,9,14H,8H2,1H3,(H,22,23) |
| InChIKey | INNAUVNCIYGWDB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|