C16H15F3N6O2 — CID 155279094
5-[[(1R)-1-[2-(difluoromethoxy)-5-fluorophenyl]ethyl]amino]-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide (PubChem CID 155279094) has the molecular formula C16H15F3N6O2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 5-[[(1R)-1-[2-(difluoromethoxy)-5-fluorophenyl]ethyl]amino]-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide.
| Compound Name | 5-[[(1R)-1-[2-(difluoromethoxy)-5-fluorophenyl]ethyl]amino]-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide |
|---|---|
| PubChem CID | 155279094 |
| Molecular Formula | C16H15F3N6O2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 5-[[(1R)-1-[2-(difluoromethoxy)-5-fluorophenyl]ethyl]amino]-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide |
| SMILES | C[C@@H](Nc1ccn2ncc(/C(N)=N/O)c2n1)c1cc(F)ccc1OC(F)F |
| InChI | InChI=1S/C16H15F3N6O2/c1-8(10-6-9(17)2-3-12(10)27-16(18)19)22-13-4-5-25-15(23-13)11(7-21-25)14(20)24-26/h2-8,16,26H,1H3,(H2,20,24)(H,22,23)/t8-/m1/s1 |
| InChIKey | WZEDOIZQDZSJOM-MRVPVSSYSA-N |
| XLogP | 2.74 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|