C25H35FN4O4Si — CID 151641092
ethyl 5-[[(1R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-5-fluorophenyl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 151641092) has the molecular formula C25H35FN4O4Si and a molecular weight of 502.66 g/mol. Its IUPAC name is ethyl 5-[[(1R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-5-fluorophenyl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[[(1R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-5-fluorophenyl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 151641092 |
| Molecular Formula | C25H35FN4O4Si |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | ethyl 5-[[(1R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-5-fluorophenyl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(N[C@H](C)c3cc(F)ccc3OCCO[Si](C)(C)C(C)(C)C)nc12 |
| InChI | InChI=1S/C25H35FN4O4Si/c1-8-32-24(31)20-16-27-30-12-11-22(29-23(20)30)28-17(2)19-15-18(26)9-10-21(19)33-13-14-34-35(6,7)25(3,4)5/h9-12,15-17H,8,13-14H2,1-7H3,(H,28,29)/t17-/m1/s1 |
| InChIKey | QSNRTALMXYVFMK-QGZVFWFLSA-N |
| XLogP | 5.62 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|