C20H20FN7O3 — CID 164829826
ethyl 5-[[(1R)-1-[(2R)-2-(azidomethyl)-5-fluoro-2,3-dihydro-1-benzofuran-7-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 164829826) has the molecular formula C20H20FN7O3 and a molecular weight of 425.42 g/mol. Its IUPAC name is ethyl 5-[[(1R)-1-[(2R)-2-(azidomethyl)-5-fluoro-2,3-dihydro-1-benzofuran-7-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[[(1R)-1-[(2R)-2-(azidomethyl)-5-fluoro-2,3-dihydro-1-benzofuran-7-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 164829826 |
| Molecular Formula | C20H20FN7O3 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 5-[[(1R)-1-[(2R)-2-(azidomethyl)-5-fluoro-2,3-dihydro-1-benzofuran-7-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(N[C@H](C)c3cc(F)cc4c3O[C@@H](CN=[N+]=[N-])C4)nc12 |
| InChI | InChI=1S/C20H20FN7O3/c1-3-30-20(29)16-10-24-28-5-4-17(26-19(16)28)25-11(2)15-8-13(21)6-12-7-14(9-23-27-22)31-18(12)15/h4-6,8,10-11,14H,3,7,9H2,1-2H3,(H,25,26)/t11-,14-/m1/s1 |
| InChIKey | DYCPVDLFCBVRRE-BXUZGUMPSA-N |
| XLogP | 3.83 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|