C21H21F2N7O3 — CID 155318854
ethyl 5-[1-[2-(azidomethyl)-5-fluoro-2-(fluoromethyl)-3H-1-benzofuran-7-yl]ethylamino]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 155318854) has the molecular formula C21H21F2N7O3 and a molecular weight of 457.44 g/mol. Its IUPAC name is ethyl 5-[1-[2-(azidomethyl)-5-fluoro-2-(fluoromethyl)-3H-1-benzofuran-7-yl]ethylamino]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[1-[2-(azidomethyl)-5-fluoro-2-(fluoromethyl)-3H-1-benzofuran-7-yl]ethylamino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 155318854 |
| Molecular Formula | C21H21F2N7O3 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | ethyl 5-[1-[2-(azidomethyl)-5-fluoro-2-(fluoromethyl)-3H-1-benzofuran-7-yl]ethylamino]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(NC(C)c3cc(F)cc4c3OC(CF)(CN=[N+]=[N-])C4)nc12 |
| InChI | InChI=1S/C21H21F2N7O3/c1-3-32-20(31)16-9-26-30-5-4-17(28-19(16)30)27-12(2)15-7-14(23)6-13-8-21(10-22,11-25-29-24)33-18(13)15/h4-7,9,12H,3,8,10-11H2,1-2H3,(H,27,28) |
| InChIKey | CLRJMQDYODBWIO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|