C16H16FIN4O2 — CID 163625527
2-[4-fluoro-2-[1-[(3-iodopyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]phenoxy]ethanol (PubChem CID 163625527) has the molecular formula C16H16FIN4O2 and a molecular weight of 442.23 g/mol. Its IUPAC name is 2-[4-fluoro-2-[1-[(3-iodopyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]phenoxy]ethanol.
| Compound Name | 2-[4-fluoro-2-[1-[(3-iodopyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 163625527 |
| Molecular Formula | C16H16FIN4O2 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-[4-fluoro-2-[1-[(3-iodopyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]phenoxy]ethanol |
| SMILES | CC(Nc1ccn2ncc(I)c2n1)c1cc(F)ccc1OCCO |
| InChI | InChI=1S/C16H16FIN4O2/c1-10(12-8-11(17)2-3-14(12)24-7-6-23)20-15-4-5-22-16(21-15)13(18)9-19-22/h2-5,8-10,23H,6-7H2,1H3,(H,20,21) |
| InChIKey | HRRBPQRRSCRGLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|