C14H11F2IN4 — CID 175003528
N-[1-(3,5-difluorophenyl)ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 175003528) has the molecular formula C14H11F2IN4 and a molecular weight of 400.17 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[1-(3,5-difluorophenyl)ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 175003528 |
| Molecular Formula | C14H11F2IN4 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)ethyl]-3-iodopyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CC(Nc1ccn2ncc(I)c2n1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F2IN4/c1-8(9-4-10(15)6-11(16)5-9)19-13-2-3-21-14(20-13)12(17)7-18-21/h2-8H,1H3,(H,19,20) |
| InChIKey | VDBLUSCKCMQIAI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|