C19H20F3N7 — CID 170680078
3-N-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-N-[(1R)-1-(2,3,5-trifluorophenyl)ethyl]pyrazolo[1,5-a]pyrimidine-3,5-diamine (PubChem CID 170680078) has the molecular formula C19H20F3N7 and a molecular weight of 403.41 g/mol. Its IUPAC name is 3-N-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-N-[(1R)-1-(2,3,5-trifluorophenyl)ethyl]pyrazolo[1,5-a]pyrimidine-3,5-diamine.
| Compound Name | 3-N-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-N-[(1R)-1-(2,3,5-trifluorophenyl)ethyl]pyrazolo[1,5-a]pyrimidine-3,5-diamine |
|---|---|
| PubChem CID | 170680078 |
| Molecular Formula | C19H20F3N7 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-N-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-N-[(1R)-1-(2,3,5-trifluorophenyl)ethyl]pyrazolo[1,5-a]pyrimidine-3,5-diamine |
| SMILES | C[C@@H](Nc1ccn2ncc(NC3=NCC(C)(C)N3)c2n1)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C19H20F3N7/c1-10(12-6-11(20)7-13(21)16(12)22)25-15-4-5-29-17(27-15)14(8-24-29)26-18-23-9-19(2,3)28-18/h4-8,10H,9H2,1-3H3,(H,25,27)(H2,23,26,28)/t10-/m1/s1 |
| InChIKey | MMZVTNYPOASLID-SNVBAGLBSA-N |
| XLogP | 3.47 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|