C20H22F3N5O2 — CID 145225079
(5R)-N-[(3R)-4-imino-5-methyl-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-methyl-5-(trifluoromethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 145225079) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is (5R)-N-[(3R)-4-imino-5-methyl-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-methyl-5-(trifluoromethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (5R)-N-[(3R)-4-imino-5-methyl-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-methyl-5-(trifluoromethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 145225079 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (5R)-N-[(3R)-4-imino-5-methyl-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-methyl-5-(trifluoromethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | [H]/N=C1/[C@@H](NC(=O)c2c3c(nn2C)CC[C@@H](C(F)(F)F)C3)COc2ccccc2N1C |
| InChI | InChI=1S/C20H22F3N5O2/c1-27-15-5-3-4-6-16(15)30-10-14(18(27)24)25-19(29)17-12-9-11(20(21,22)23)7-8-13(12)26-28(17)2/h3-6,11,14,24H,7-10H2,1-2H3,(H,25,29)/b24-18-/t11-,14+/m1/s1 |
| InChIKey | ZFRDDHPSNDXBLI-SRMDNKFJSA-N |
| XLogP | 2.69 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|