C20H25N3O4 — CID 155480072
(5R)-1,5-dimethyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-5,6,7,7a-tetrahydro-4H-2,1-benzoxazole-3-carboxamide (PubChem CID 155480072) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (5R)-1,5-dimethyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-5,6,7,7a-tetrahydro-4H-2,1-benzoxazole-3-carboxamide.
| Compound Name | (5R)-1,5-dimethyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-5,6,7,7a-tetrahydro-4H-2,1-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 155480072 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (5R)-1,5-dimethyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-5,6,7,7a-tetrahydro-4H-2,1-benzoxazole-3-carboxamide |
| SMILES | C[C@@H]1CCC2C(=C(C(=O)N[C@H]3COc4ccccc4N(C)C3=O)ON2C)C1 |
| InChI | InChI=1S/C20H25N3O4/c1-12-8-9-15-13(10-12)18(27-23(15)3)19(24)21-14-11-26-17-7-5-4-6-16(17)22(2)20(14)25/h4-7,12,14-15H,8-11H2,1-3H3,(H,21,24)/t12-,14+,15?/m1/s1 |
| InChIKey | LILLZRNDBVBNGH-JEIKQXNFSA-N |
| XLogP | 1.85 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |