About ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide
ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide (PubChem CID 145225165) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide |
| PubChem CID | 145225165 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide |
| SMILES | CC.CNC(=O)c1cc2[nH]ncc2cn1 |
| InChI | InChI=1S/C8H8N4O.C2H6/c1-9-8(13)7-2-6-5(3-10-7)4-11-12-6;1-2/h2-4H,1H3,(H,9,13)(H,11,12);1-2H3 |
| InChIKey | JFFXNTOKPPCNKP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide?
The IUPAC name of ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide (CID 145225165) is ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide.
What is the SMILES notation for ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide?
The canonical SMILES for ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide is CC.CNC(=O)c1cc2[nH]ncc2cn1.
What is the InChIKey of ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide?
The InChIKey is JFFXNTOKPPCNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O.C2H6/c1-9-8(13)7-2-6-5(3-10-7)4-11-12-6;1-2/h2-4H,1H3,(H,9,13)(H,11,12);1-2H3.
What are the key properties of ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide?
ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide has a molecular weight of 206.25 g/mol, XLogP of 1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1H-pyrazolo[4,3-c]pyridine-6-carboxamide is sourced from PubChem (CID 145225165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).