C10H18N4O — CID 178148227
N,5-dimethyl-6-(methylamino)pyrazine-2-carboxamide;ethane (PubChem CID 178148227) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N,5-dimethyl-6-(methylamino)pyrazine-2-carboxamide;ethane.
| Compound Name | N,5-dimethyl-6-(methylamino)pyrazine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 178148227 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N,5-dimethyl-6-(methylamino)pyrazine-2-carboxamide;ethane |
| SMILES | CC.CNC(=O)c1cnc(C)c(NC)n1 |
| InChI | InChI=1S/C8H12N4O.C2H6/c1-5-7(9-2)12-6(4-11-5)8(13)10-3;1-2/h4H,1-3H3,(H,9,12)(H,10,13);1-2H3 |
| InChIKey | ATALGWDHUKTJKY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |