C19H22N8O2 — CID 145225174
1-(2,3-dihydropyridin-2-ylmethyl)-N-[(2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide (PubChem CID 145225174) has the molecular formula C19H22N8O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-(2,3-dihydropyridin-2-ylmethyl)-N-[(2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2,3-dihydropyridin-2-ylmethyl)-N-[(2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 145225174 |
| Molecular Formula | C19H22N8O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(2,3-dihydropyridin-2-ylmethyl)-N-[(2,4-dimethyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc2n(n1)CCC(/C=N/C(=O)c1ncn(CC3CC=CC=N3)n1)C(=O)N2C |
| InChI | InChI=1S/C19H22N8O2/c1-13-9-16-25(2)19(29)14(6-8-27(16)23-13)10-21-18(28)17-22-12-26(24-17)11-15-5-3-4-7-20-15/h3-4,7,9-10,12,14-15H,5-6,8,11H2,1-2H3/b21-10+ |
| InChIKey | LWEAIBLVXPZRBP-UFFVCSGVSA-N |
| XLogP | 1.08 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|